C28H30N2O — CID 67825543
N-[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]-1-(4-methoxyphenyl)methanimine (PubChem CID 67825543) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 67825543 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/[C@@H]2C3CCN(CC3)[C@H]2C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O/c1-31-25-14-12-21(13-15-25)20-29-27-24-16-18-30(19-17-24)28(27)26(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-15,20,24,26-28H,16-19H2,1H3/b29-20+/t27-,28+/m1/s1 |
| InChIKey | LKDIQMMCUZGPDG-DLURHKRVSA-N |
| XLogP | 5.41 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|