C28H28Br2N2O — CID 67918703
N-[(2S,3R)-2-[bis(4-bromophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]-1-(2-methoxyphenyl)methanimine (PubChem CID 67918703) has the molecular formula C28H28Br2N2O and a molecular weight of 568.35 g/mol. Its IUPAC name is N-[(2S,3R)-2-[bis(4-bromophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]-1-(2-methoxyphenyl)methanimine.
| Compound Name | N-[(2S,3R)-2-[bis(4-bromophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]-1-(2-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 67918703 |
| Molecular Formula | C28H28Br2N2O |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | N-[(2S,3R)-2-[bis(4-bromophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-yl]-1-(2-methoxyphenyl)methanimine |
| SMILES | COc1ccccc1/C=N/[C@@H]1C2CCN(CC2)[C@H]1C(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H28Br2N2O/c1-33-25-5-3-2-4-22(25)18-31-27-21-14-16-32(17-15-21)28(27)26(19-6-10-23(29)11-7-19)20-8-12-24(30)13-9-20/h2-13,18,21,26-28H,14-17H2,1H3/b31-18+/t27-,28+/m1/s1 |
| InChIKey | RWVWIPLHPQKDRU-NIWJDOBFSA-N |
| XLogP | 6.93 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|