C29H30ClNO5 — CID 67857623
(2R,3R)-2-benzhydryl-3-[(4-chlorophenyl)methoxy]-1-azabicyclo[2.2.2]octane;oxalic acid (PubChem CID 67857623) has the molecular formula C29H30ClNO5 and a molecular weight of 508.01 g/mol. Its IUPAC name is (2R,3R)-2-benzhydryl-3-[(4-chlorophenyl)methoxy]-1-azabicyclo[2.2.2]octane;oxalic acid.
| Compound Name | (2R,3R)-2-benzhydryl-3-[(4-chlorophenyl)methoxy]-1-azabicyclo[2.2.2]octane;oxalic acid |
|---|---|
| PubChem CID | 67857623 |
| Molecular Formula | C29H30ClNO5 |
| Molecular Weight | 508.01 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (2R,3R)-2-benzhydryl-3-[(4-chlorophenyl)methoxy]-1-azabicyclo[2.2.2]octane;oxalic acid |
| SMILES | Clc1ccc(CO[C@@H]2C3CCN(CC3)[C@@H]2C(c2ccccc2)c2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H28ClNO.C2H2O4/c28-24-13-11-20(12-14-24)19-30-27-23-15-17-29(18-16-23)26(27)25(21-7-3-1-4-8-21)22-9-5-2-6-10-22;3-1(4)2(5)6/h1-14,23,25-27H,15-19H2;(H,3,4)(H,5,6)/t26-,27-;/m1./s1 |
| InChIKey | JIRMHQREMQVRNF-CNZCJKERSA-N |
| XLogP | 5.31 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.01 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|