C21H29NO — CID 139704858
2-hepta-1,6-dien-4-yl-3-phenylmethoxy-1-azabicyclo[2.2.2]octane (PubChem CID 139704858) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-hepta-1,6-dien-4-yl-3-phenylmethoxy-1-azabicyclo[2.2.2]octane.
| Compound Name | 2-hepta-1,6-dien-4-yl-3-phenylmethoxy-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 139704858 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-hepta-1,6-dien-4-yl-3-phenylmethoxy-1-azabicyclo[2.2.2]octane |
| SMILES | C=CCC(CC=C)C1C(OCc2ccccc2)C2CCN1CC2 |
| InChI | InChI=1S/C21H29NO/c1-3-8-18(9-4-2)20-21(19-12-14-22(20)15-13-19)23-16-17-10-6-5-7-11-17/h3-7,10-11,18-21H,1-2,8-9,12-16H2 |
| InChIKey | UEVAMMWIYSTEHX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|