C23H29NO8 — CID 10813318
3-[4-(dimethylamino)phenyl]-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one (PubChem CID 10813318) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 10813318 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propan-1-one |
| SMILES | CN(C)c1ccc(CCC(=O)c2c(O)cccc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H29NO8/c1-24(2)14-9-6-13(7-10-14)8-11-16(27)19-15(26)4-3-5-17(19)31-23-22(30)21(29)20(28)18(12-25)32-23/h3-7,9-10,18,20-23,25-26,28-30H,8,11-12H2,1-2H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | YICKXTHVMMYXDJ-DODNOZFWSA-N |
| XLogP | 0.45 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|