C24H23NO4Se — CID 10814120
(4S,4aS,7aS,12bR)-9-methoxy-3-methyl-6-phenylselanyl-4,4a,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-2,7-dione (PubChem CID 10814120) has the molecular formula C24H23NO4Se and a molecular weight of 468.41 g/mol. Its IUPAC name is (4S,4aS,7aS,12bR)-9-methoxy-3-methyl-6-phenylselanyl-4,4a,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-2,7-dione.
| Compound Name | (4S,4aS,7aS,12bR)-9-methoxy-3-methyl-6-phenylselanyl-4,4a,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-2,7-dione |
|---|---|
| PubChem CID | 10814120 |
| Molecular Formula | C24H23NO4Se |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (4S,4aS,7aS,12bR)-9-methoxy-3-methyl-6-phenylselanyl-4,4a,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-2,7-dione |
| SMILES | COc1ccc2c3c1O[C@@H]1C(=O)C([Se]c4ccccc4)C[C@@H]4[C@H](C2)N(C)C(=O)C[C@@]314 |
| InChI | InChI=1S/C24H23NO4Se/c1-25-16-10-13-8-9-17(28-2)22-20(13)24(12-19(25)26)15(16)11-18(21(27)23(24)29-22)30-14-6-4-3-5-7-14/h3-9,15-16,18,23H,10-12H2,1-2H3/t15-,16+,18?,23-,24-/m1/s1 |
| InChIKey | IOHKKLKXEIGMER-CQBUHBTLSA-N |
| XLogP | 1.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|