C25H44O4Sn — CID 10815970
dimethyl (4E)-3-prop-1-en-2-yl-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10815970) has the molecular formula C25H44O4Sn and a molecular weight of 527.33 g/mol. Its IUPAC name is dimethyl (4E)-3-prop-1-en-2-yl-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-prop-1-en-2-yl-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10815970 |
| Molecular Formula | C25H44O4Sn |
| Molecular Weight | 527.33 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | dimethyl (4E)-3-prop-1-en-2-yl-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C)C1CC(C(=O)OC)(C(=O)OC)C/C1=C\[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C13H17O4.3C4H9.Sn/c1-8(2)10-7-13(6-9(10)3,11(14)16-4)12(15)17-5;3*1-3-4-2;/h3,10H,1,6-7H2,2,4-5H3;3*1,3-4H2,2H3; |
| InChIKey | GPMUNOUBPKGTAZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.33 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|