C37H58O5S — CID 10817570
(1S,2S,5R,6R,9S,10R,13S,15R,18R,20S)-18-(benzenesulfonylmethyl)-15-methoxy-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosane (PubChem CID 10817570) has the molecular formula C37H58O5S and a molecular weight of 614.93 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S,15R,18R,20S)-18-(benzenesulfonylmethyl)-15-methoxy-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosane.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S,15R,18R,20S)-18-(benzenesulfonylmethyl)-15-methoxy-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosane |
|---|---|
| PubChem CID | 10817570 |
| Molecular Formula | C37H58O5S |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S,15R,18R,20S)-18-(benzenesulfonylmethyl)-15-methoxy-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosane |
| SMILES | CO[C@@]12C[C@@H]3CC[C@@H]4[C@H](CC[C@]5(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]45)[C@@]3(C)C[C@H]1C[C@H](CS(=O)(=O)c1ccccc1)OO2 |
| InChI | InChI=1S/C37H58O5S/c1-25(2)11-10-12-26(3)32-17-18-33-31-16-15-27-23-37(40-6)28(22-36(27,5)34(31)19-20-35(32,33)4)21-29(41-42-37)24-43(38,39)30-13-8-7-9-14-30/h7-9,13-14,25-29,31-34H,10-12,15-24H2,1-6H3/t26-,27+,28-,29-,31+,32-,33+,34+,35-,36+,37-/m1/s1 |
| InChIKey | GLQODLZAIYCHBB-QPYADNFMSA-N |
| XLogP | 8.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|