C36H55IO5S — CID 10509118
(1S,2S,5R,6R,9S,10R,13S,18R,20R)-18-(benzenesulfonylmethyl)-20-iodo-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxatetracyclo[11.8.0.02,10.05,9]henicosan-15-one (PubChem CID 10509118) has the molecular formula C36H55IO5S and a molecular weight of 726.80 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R,13S,18R,20R)-18-(benzenesulfonylmethyl)-20-iodo-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxatetracyclo[11.8.0.02,10.05,9]henicosan-15-one.
| Compound Name | (1S,2S,5R,6R,9S,10R,13S,18R,20R)-18-(benzenesulfonylmethyl)-20-iodo-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxatetracyclo[11.8.0.02,10.05,9]henicosan-15-one |
|---|---|
| PubChem CID | 10509118 |
| Molecular Formula | C36H55IO5S |
| Molecular Weight | 726.80 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R,13S,18R,20R)-18-(benzenesulfonylmethyl)-20-iodo-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-16,17-dioxatetracyclo[11.8.0.02,10.05,9]henicosan-15-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)OO[C@@H](CS(=O)(=O)c5ccccc5)C[C@H](I)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H55IO5S/c1-24(2)10-9-11-25(3)31-16-17-32-30-15-14-26-20-34(38)42-41-28(23-43(39,40)29-12-7-6-8-13-29)21-27(37)22-36(26,5)33(30)18-19-35(31,32)4/h6-8,12-13,24-28,30-33H,9-11,14-23H2,1-5H3/t25-,26+,27+,28-,30+,31-,32+,33+,35-,36+/m1/s1 |
| InChIKey | QGIQMDLECCXCJS-KRBIANFSSA-N |
| XLogP | 9.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.80 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|