C36H56O5S — CID 134882290
(1S,5R,13S,15R,18S,20S)-18-(benzenesulfonylmethyl)-1,5-dimethyl-6-(6-methylheptan-2-yl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol (PubChem CID 134882290) has the molecular formula C36H56O5S and a molecular weight of 600.91 g/mol. Its IUPAC name is (1S,5R,13S,15R,18S,20S)-18-(benzenesulfonylmethyl)-1,5-dimethyl-6-(6-methylheptan-2-yl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol.
| Compound Name | (1S,5R,13S,15R,18S,20S)-18-(benzenesulfonylmethyl)-1,5-dimethyl-6-(6-methylheptan-2-yl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol |
|---|---|
| PubChem CID | 134882290 |
| Molecular Formula | C36H56O5S |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | (1S,5R,13S,15R,18S,20S)-18-(benzenesulfonylmethyl)-1,5-dimethyl-6-(6-methylheptan-2-yl)-16,17-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosan-15-ol |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC[C@H]4C[C@@]5(O)OO[C@H](CS(=O)(=O)c6ccccc6)C[C@@H]5C[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C36H56O5S/c1-24(2)10-9-11-25(3)31-16-17-32-30-15-14-26-22-36(37)27(21-35(26,5)33(30)18-19-34(31,32)4)20-28(40-41-36)23-42(38,39)29-12-7-6-8-13-29/h6-8,12-13,24-28,30-33,37H,9-11,14-23H2,1-5H3/t25?,26-,27+,28-,30?,31?,32?,33?,34+,35-,36+/m0/s1 |
| InChIKey | JOTLMHPLNPNKRB-DHUSPWPXSA-N |
| XLogP | 8.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|