C35H49ClO — CID 2748385
(4R,6R)-6-[2-(2-chlorophenyl)ethynyl]-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane (PubChem CID 2748385) has the molecular formula C35H49ClO and a molecular weight of 521.23 g/mol. Its IUPAC name is (4R,6R)-6-[2-(2-chlorophenyl)ethynyl]-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane.
| Compound Name | (4R,6R)-6-[2-(2-chlorophenyl)ethynyl]-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
|---|---|
| PubChem CID | 2748385 |
| Molecular Formula | C35H49ClO |
| Molecular Weight | 521.23 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | (4R,6R)-6-[2-(2-chlorophenyl)ethynyl]-2,16-dimethyl-15-(6-methylheptan-2-yl)-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4C[C@]5(C#Cc6ccccc6Cl)O[C@@H]5CC4(C)C3CCC12C |
| InChI | InChI=1S/C35H49ClO/c1-23(2)9-8-10-24(3)28-15-16-29-27-14-13-26-21-35(20-17-25-11-6-7-12-31(25)36)32(37-35)22-34(26,5)30(27)18-19-33(28,29)4/h6-7,11-12,23-24,26-30,32H,8-10,13-16,18-19,21-22H2,1-5H3/t24?,26?,27?,28?,29?,30?,32-,33?,34?,35+/m1/s1 |
| InChIKey | ODAVHYDVKXKKQV-VAJJALDHSA-N |
| XLogP | 9.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.23 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|