C8H12O2 — CID 10820609
1-(2,3-dihydrofuran-5-yl)cyclobutan-1-ol (PubChem CID 10820609) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)cyclobutan-1-ol.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 10820609 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)cyclobutan-1-ol |
| SMILES | OC1(C2=CCCO2)CCC1 |
| InChI | InChI=1S/C8H12O2/c9-8(4-2-5-8)7-3-1-6-10-7/h3,9H,1-2,4-6H2 |
| InChIKey | SFRYRBFXUUAXQZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |