C7H12Cl2O — CID 10821315
(3S,4R)-3-(2,2-dichloroethyl)-4-methyloxolane (PubChem CID 10821315) has the molecular formula C7H12Cl2O and a molecular weight of 183.08 g/mol. Its IUPAC name is (3S,4R)-3-(2,2-dichloroethyl)-4-methyloxolane.
| Compound Name | (3S,4R)-3-(2,2-dichloroethyl)-4-methyloxolane |
|---|---|
| PubChem CID | 10821315 |
| Molecular Formula | C7H12Cl2O |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | (3S,4R)-3-(2,2-dichloroethyl)-4-methyloxolane |
| SMILES | C[C@H]1COC[C@H]1CC(Cl)Cl |
| InChI | InChI=1S/C7H12Cl2O/c1-5-3-10-4-6(5)2-7(8)9/h5-7H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | CXNLPDHVTXWNIC-NTSWFWBYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|