C12H19NO4 — CID 10824020
methyl (4aR,8aS)-8a-(hydroxymethyl)-6-oxo-3,4,4a,5,7,8-hexahydro-1H-isoquinoline-2-carboxylate (PubChem CID 10824020) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl (4aR,8aS)-8a-(hydroxymethyl)-6-oxo-3,4,4a,5,7,8-hexahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl (4aR,8aS)-8a-(hydroxymethyl)-6-oxo-3,4,4a,5,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 10824020 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl (4aR,8aS)-8a-(hydroxymethyl)-6-oxo-3,4,4a,5,7,8-hexahydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CC(=O)CC[C@@]2(CO)C1 |
| InChI | InChI=1S/C12H19NO4/c1-17-11(16)13-5-3-9-6-10(15)2-4-12(9,7-13)8-14/h9,14H,2-8H2,1H3/t9-,12+/m1/s1 |
| InChIKey | KPYCIKCLTWJAHE-SKDRFNHKSA-N |
| XLogP | 0.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |