C15H20O3 — CID 10824457
6-methoxy-1-methyl-2-propan-2-ylnaphthalene-1,2-diol (PubChem CID 10824457) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 6-methoxy-1-methyl-2-propan-2-ylnaphthalene-1,2-diol.
| Compound Name | 6-methoxy-1-methyl-2-propan-2-ylnaphthalene-1,2-diol |
|---|---|
| PubChem CID | 10824457 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 6-methoxy-1-methyl-2-propan-2-ylnaphthalene-1,2-diol |
| SMILES | COc1ccc2c(c1)C=CC(O)(C(C)C)C2(C)O |
| InChI | InChI=1S/C15H20O3/c1-10(2)15(17)8-7-11-9-12(18-4)5-6-13(11)14(15,3)16/h5-10,16-17H,1-4H3 |
| InChIKey | PFACZYXHYXDDBD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |