C17H17NO2 — CID 125494447
N-[(2R)-6-methoxy-2-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]hydroxylamine (PubChem CID 125494447) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(2R)-6-methoxy-2-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]hydroxylamine.
| Compound Name | N-[(2R)-6-methoxy-2-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]hydroxylamine |
|---|---|
| PubChem CID | 125494447 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(2R)-6-methoxy-2-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]hydroxylamine |
| SMILES | COc1ccc2c(c1)C=Cc1ccccc1[C@@]2(C)NO |
| InChI | InChI=1S/C17H17NO2/c1-17(18-19)15-6-4-3-5-12(15)7-8-13-11-14(20-2)9-10-16(13)17/h3-11,18-19H,1-2H3/t17-/m1/s1 |
| InChIKey | QNIYLMVQAQLWLM-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|