C21H20O2 — CID 138963859
5-methoxy-3,3-dimethylspiro[2H-indene-1,1'-naphthalene]-2'-one (PubChem CID 138963859) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-methoxy-3,3-dimethylspiro[2H-indene-1,1'-naphthalene]-2'-one.
| Compound Name | 5-methoxy-3,3-dimethylspiro[2H-indene-1,1'-naphthalene]-2'-one |
|---|---|
| PubChem CID | 138963859 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-methoxy-3,3-dimethylspiro[2H-indene-1,1'-naphthalene]-2'-one |
| SMILES | COc1ccc2c(c1)C(C)(C)CC21C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C21H20O2/c1-20(2)13-21(17-10-9-15(23-3)12-18(17)20)16-7-5-4-6-14(16)8-11-19(21)22/h4-12H,13H2,1-3H3 |
| InChIKey | CXZVTIFBLALYKC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |