C21H21NO3 — CID 15684122
6,7-dimethoxy-1-methylspiro[2,4-dihydroquinoline-3,1'-naphthalene]-2'-one (PubChem CID 15684122) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methylspiro[2,4-dihydroquinoline-3,1'-naphthalene]-2'-one.
| Compound Name | 6,7-dimethoxy-1-methylspiro[2,4-dihydroquinoline-3,1'-naphthalene]-2'-one |
|---|---|
| PubChem CID | 15684122 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 6,7-dimethoxy-1-methylspiro[2,4-dihydroquinoline-3,1'-naphthalene]-2'-one |
| SMILES | COc1cc2c(cc1OC)N(C)CC1(C2)C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C21H21NO3/c1-22-13-21(16-7-5-4-6-14(16)8-9-20(21)23)12-15-10-18(24-2)19(25-3)11-17(15)22/h4-11H,12-13H2,1-3H3 |
| InChIKey | FDMYHUQNVAAZRU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|