C21H24N2O2 — CID 71729121
(1R,5S,13S)-9,10-dimethoxy-14-methyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene (PubChem CID 71729121) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (1R,5S,13S)-9,10-dimethoxy-14-methyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene.
| Compound Name | (1R,5S,13S)-9,10-dimethoxy-14-methyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene |
|---|---|
| PubChem CID | 71729121 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1R,5S,13S)-9,10-dimethoxy-14-methyl-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15,17,19-hexaene |
| SMILES | COc1cc2c(cc1OC)[C@@H]1N(C)c3ccccc3[C@@]13CCN[C@H]3C2 |
| InChI | InChI=1S/C21H24N2O2/c1-23-16-7-5-4-6-15(16)21-8-9-22-19(21)11-13-10-17(24-2)18(25-3)12-14(13)20(21)23/h4-7,10,12,19-20,22H,8-9,11H2,1-3H3/t19-,20-,21+/m0/s1 |
| InChIKey | RCKQLCUYRZWZDE-PCCBWWKXSA-N |
| XLogP | 3.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|