About 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one
2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one (PubChem CID 11955883) has the molecular formula C14H15F3O3
and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one |
| PubChem CID | 11955883 |
| Molecular Formula | C14H15F3O3 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one |
| SMILES | COc1ccc2c(c1)C(C)(C)CC(O)(C(F)(F)F)C2=O |
| InChI | InChI=1S/C14H15F3O3/c1-12(2)7-13(19,14(15,16)17)11(18)9-5-4-8(20-3)6-10(9)12/h4-6,19H,7H2,1-3H3 |
| InChIKey | VFKHFOYUOWNUGT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one?
The IUPAC name of 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one (CID 11955883) is 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one.
What is the SMILES notation for 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one?
The canonical SMILES for 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one is COc1ccc2c(c1)C(C)(C)CC(O)(C(F)(F)F)C2=O.
What is the InChIKey of 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one?
The InChIKey is VFKHFOYUOWNUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O3/c1-12(2)7-13(19,14(15,16)17)11(18)9-5-4-8(20-3)6-10(9)12/h4-6,19H,7H2,1-3H3.
What are the key properties of 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one?
2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one has a molecular weight of 288.26 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-methoxy-4,4-dimethyl-2-(trifluoromethyl)-3H-naphthalen-1-one is sourced from PubChem (CID 11955883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).