C12H13NO3 — CID 16743268
(2E)-2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one (PubChem CID 16743268) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one.
| Compound Name | (2E)-2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one |
|---|---|
| PubChem CID | 16743268 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2E)-2-hydroxyimino-6-methoxy-3,3-dimethylinden-1-one |
| SMILES | COc1ccc2c(c1)C(=O)/C(=N/O)C2(C)C |
| InChI | InChI=1S/C12H13NO3/c1-12(2)9-5-4-7(16-3)6-8(9)10(14)11(12)13-15/h4-6,15H,1-3H3/b13-11- |
| InChIKey | QEOQPJMRMBOFFQ-QBFSEMIESA-N |
| XLogP | 2.00 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|