About (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile
(E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile (PubChem CID 134375586) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile |
| PubChem CID | 134375586 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile |
| SMILES | COc1ccc2c(c1)C(=O)c1c([nH]c(/C=C(\C)C#N)c1C)C2(C)C |
| InChI | InChI=1S/C20H20N2O2/c1-11(10-21)8-16-12(2)17-18(23)14-9-13(24-5)6-7-15(14)20(3,4)19(17)22-16/h6-9,22H,1-5H3/b11-8+ |
| InChIKey | BBWNFCJULIIUAE-DHZHZOJOSA-N |
| XLogP | 4.13 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile?
The IUPAC name of (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile (CID 134375586) is (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile.
What is the SMILES notation for (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile?
The canonical SMILES for (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile is COc1ccc2c(c1)C(=O)c1c([nH]c(/C=C(\C)C#N)c1C)C2(C)C.
What is the InChIKey of (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile?
The InChIKey is BBWNFCJULIIUAE-DHZHZOJOSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-11(10-21)8-16-12(2)17-18(23)14-9-13(24-5)6-7-15(14)20(3,4)19(17)22-16/h6-9,22H,1-5H3/b11-8+.
What are the key properties of (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile?
(E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile has a molecular weight of 320.39 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(6-methoxy-3,9,9-trimethyl-4-oxo-1H-benzo[f]indol-2-yl)-2-methylprop-2-enenitrile is sourced from PubChem (CID 134375586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).