C17H14O2 — CID 67795281
(10Z)-14-methoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol (PubChem CID 67795281) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (10Z)-14-methoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol.
| Compound Name | (10Z)-14-methoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol |
|---|---|
| PubChem CID | 67795281 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (10Z)-14-methoxytricyclo[10.4.0.04,9]hexadeca-1(12),2,4,6,8,10,13,15-octaen-2-ol |
| SMILES | COc1ccc2c(c1)/C=C\c1ccccc1C=C2O |
| InChI | InChI=1S/C17H14O2/c1-19-15-8-9-16-14(10-15)7-6-12-4-2-3-5-13(12)11-17(16)18/h2-11,18H,1H3/b7-6-,12-6-,13-11?,14-7-,17-11?,17-16? |
| InChIKey | CKXXKIOKPGBBLK-QATVYHOTSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|