C14H24O4 — CID 10824978
ethyl (Z)-2-ethyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxybut-2-enoate (PubChem CID 10824978) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is ethyl (Z)-2-ethyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxybut-2-enoate.
| Compound Name | ethyl (Z)-2-ethyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxybut-2-enoate |
|---|---|
| PubChem CID | 10824978 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | ethyl (Z)-2-ethyl-3-[(1S,2S)-2-hydroxycyclohexyl]oxybut-2-enoate |
| SMILES | CCOC(=O)/C(CC)=C(/C)O[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H24O4/c1-4-11(14(16)17-5-2)10(3)18-13-9-7-6-8-12(13)15/h12-13,15H,4-9H2,1-3H3/b11-10-/t12-,13-/m0/s1 |
| InChIKey | DYAHZRUUNWAIDO-XOFVUTBISA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|