C14H15N3O2 — CID 10825034
(1E,3E)-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobuta-1,3-dien-1-amine (PubChem CID 10825034) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is (1E,3E)-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobuta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 10825034 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (1E,3E)-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobuta-1,3-dien-1-amine |
| SMILES | O=[N+]([O-])/C=C/C=C/NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H15N3O2/c18-17(19)10-4-3-8-15-9-7-12-11-16-14-6-2-1-5-13(12)14/h1-6,8,10-11,15-16H,7,9H2/b8-3+,10-4+ |
| InChIKey | FNZMBEVRKVOWQE-KLXHRMLDSA-N |
| XLogP | 2.60 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|