C15H17NO3 — CID 10825179
ethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 10825179) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 10825179 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN(Cc2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C15H17NO3/c1-2-19-15(18)13-8-9-14(17)16(11-13)10-12-6-4-3-5-7-12/h3-7,11H,2,8-10H2,1H3 |
| InChIKey | ZUYODBWSNQSJEW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |