C16H13NOS — CID 10825744
8-methyl-6-thia-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,9,11,13,15-hexaen-17-one (PubChem CID 10825744) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is 8-methyl-6-thia-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,9,11,13,15-hexaen-17-one.
| Compound Name | 8-methyl-6-thia-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,9,11,13,15-hexaen-17-one |
|---|---|
| PubChem CID | 10825744 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 8-methyl-6-thia-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,9,11,13,15-hexaen-17-one |
| SMILES | CC1C=C2c3ccccc3C(=O)N2Cc2ccsc21 |
| InChI | InChI=1S/C16H13NOS/c1-10-8-14-12-4-2-3-5-13(12)16(18)17(14)9-11-6-7-19-15(10)11/h2-8,10H,9H2,1H3 |
| InChIKey | DASQQFGOHRNYNC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |