C9H6F6N2S — CID 10827172
S-[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]thiohydroxylamine (PubChem CID 10827172) has the molecular formula C9H6F6N2S and a molecular weight of 288.22 g/mol. Its IUPAC name is S-[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]thiohydroxylamine.
| Compound Name | S-[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]thiohydroxylamine |
|---|---|
| PubChem CID | 10827172 |
| Molecular Formula | C9H6F6N2S |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | S-[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]thiohydroxylamine |
| SMILES | NS/N=C(\c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H6F6N2S/c10-8(11,12)6-3-1-2-5(4-6)7(17-18-16)9(13,14)15/h1-4H,16H2/b17-7+ |
| InChIKey | JBBPTZBMWHKOQG-REZTVBANSA-N |
| XLogP | 3.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|