C14H16ClN5 — CID 10827325
1,5,8-trimethyl-N-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-3-amine chloride (PubChem CID 10827325) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 1,5,8-trimethyl-N-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-3-amine chloride.
| Compound Name | 1,5,8-trimethyl-N-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-3-amine chloride |
|---|---|
| PubChem CID | 10827325 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1,5,8-trimethyl-N-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-3-amine chloride |
| SMILES | Cc1ncc(C)[n+]2c(Nc3ccccc3)nn(C)c12.[Cl-] |
| InChI | InChI=1S/C14H16N5.ClH/c1-10-9-15-11(2)13-18(3)17-14(19(10)13)16-12-7-5-4-6-8-12;/h4-9H,1-3H3,(H,16,17);1H/q+1;/p-1 |
| InChIKey | BZVXCUSCFAZZMI-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 46.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|