C10H12N3P — CID 135534849
2,5-dimethyl-N-phenyldiazaphosphol-4-amine (PubChem CID 135534849) has the molecular formula C10H12N3P and a molecular weight of 205.20 g/mol. Its IUPAC name is 2,5-dimethyl-N-phenyldiazaphosphol-4-amine.
| Compound Name | 2,5-dimethyl-N-phenyldiazaphosphol-4-amine |
|---|---|
| PubChem CID | 135534849 |
| Molecular Formula | C10H12N3P |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 2,5-dimethyl-N-phenyldiazaphosphol-4-amine |
| SMILES | Cc1nn(C)pc1Nc1ccccc1 |
| InChI | InChI=1S/C10H12N3P/c1-8-10(14-13(2)12-8)11-9-6-4-3-5-7-9/h3-7,11H,1-2H3 |
| InChIKey | RTNCHKHGCRJTNL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |