C14H34O3Si2 — CID 10828514
1,1-diethoxy-3-trimethylsilyl-2-(trimethylsilylmethyl)propan-2-ol (PubChem CID 10828514) has the molecular formula C14H34O3Si2 and a molecular weight of 306.60 g/mol. Its IUPAC name is 1,1-diethoxy-3-trimethylsilyl-2-(trimethylsilylmethyl)propan-2-ol.
| Compound Name | 1,1-diethoxy-3-trimethylsilyl-2-(trimethylsilylmethyl)propan-2-ol |
|---|---|
| PubChem CID | 10828514 |
| Molecular Formula | C14H34O3Si2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1,1-diethoxy-3-trimethylsilyl-2-(trimethylsilylmethyl)propan-2-ol |
| SMILES | CCOC(OCC)C(O)(C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C14H34O3Si2/c1-9-16-13(17-10-2)14(15,11-18(3,4)5)12-19(6,7)8/h13,15H,9-12H2,1-8H3 |
| InChIKey | WPAVUYHWDYSYIY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|