C21H30O2 — CID 10829104
(1S,3R,7Z,9E,12S,13S,14R)-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadeca-4,7,9-trien-2-one (PubChem CID 10829104) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,3R,7Z,9E,12S,13S,14R)-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadeca-4,7,9-trien-2-one.
| Compound Name | (1S,3R,7Z,9E,12S,13S,14R)-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadeca-4,7,9-trien-2-one |
|---|---|
| PubChem CID | 10829104 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1S,3R,7Z,9E,12S,13S,14R)-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadeca-4,7,9-trien-2-one |
| SMILES | CO[C@@H]1[C@H]2C/C(C)=C/C=C3/C(C)(C)C=C[C@@]3(C)C(=O)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C21H30O2/c1-13-7-8-17-20(3,4)9-10-21(17,5)19(22)16-12-14(2)18(23-6)15(16)11-13/h7-10,14-16,18H,11-12H2,1-6H3/b13-7+,17-8-/t14-,15+,16+,18+,21-/m1/s1 |
| InChIKey | AQVFYOZBFMGQHU-VTUMVFGZSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|