C16H19NO4S — CID 10829603
[(1S)-1-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-ynyl] acetate (PubChem CID 10829603) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is [(1S)-1-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-ynyl] acetate.
| Compound Name | [(1S)-1-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-ynyl] acetate |
|---|---|
| PubChem CID | 10829603 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [(1S)-1-[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-ynyl] acetate |
| SMILES | C#C[C@H](OC(C)=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-4-16(21-13(3)18)15-6-5-11-17(15)22(19,20)14-9-7-12(2)8-10-14/h1,7-10,15-16H,5-6,11H2,2-3H3/t15-,16-/m0/s1 |
| InChIKey | QBNCFWVIPYSAJR-HOTGVXAUSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|