C18H34OSi2 — CID 10829718
tert-butyl-(4,4-dimethyl-7-trimethylsilylhepta-1,6-diyn-3-yl)oxy-dimethylsilane (PubChem CID 10829718) has the molecular formula C18H34OSi2 and a molecular weight of 322.64 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethyl-7-trimethylsilylhepta-1,6-diyn-3-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(4,4-dimethyl-7-trimethylsilylhepta-1,6-diyn-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10829718 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl-(4,4-dimethyl-7-trimethylsilylhepta-1,6-diyn-3-yl)oxy-dimethylsilane |
| SMILES | C#CC(O[Si](C)(C)C(C)(C)C)C(C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi2/c1-12-16(19-21(10,11)17(2,3)4)18(5,6)14-13-15-20(7,8)9/h1,16H,14H2,2-11H3 |
| InChIKey | YNDCKCCDIOGIRF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|