C20H38OSi2 — CID 135078902
tert-butyl-(4,4-dimethyl-1-trimethylsilylnona-1,7-diyn-5-yl)oxy-dimethylsilane (PubChem CID 135078902) has the molecular formula C20H38OSi2 and a molecular weight of 350.70 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethyl-1-trimethylsilylnona-1,7-diyn-5-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(4,4-dimethyl-1-trimethylsilylnona-1,7-diyn-5-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 135078902 |
| Molecular Formula | C20H38OSi2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | tert-butyl-(4,4-dimethyl-1-trimethylsilylnona-1,7-diyn-5-yl)oxy-dimethylsilane |
| SMILES | CC#CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C20H38OSi2/c1-12-13-15-18(21-23(10,11)19(2,3)4)20(5,6)16-14-17-22(7,8)9/h18H,15-16H2,1-11H3 |
| InChIKey | RDDBMTIXDRZKIB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|