C19H36OSi2 — CID 10664651
tert-butyl-(4,4-dimethyl-1-trimethylsilylocta-1,6-diyn-3-yl)oxy-dimethylsilane (PubChem CID 10664651) has the molecular formula C19H36OSi2 and a molecular weight of 336.67 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethyl-1-trimethylsilylocta-1,6-diyn-3-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(4,4-dimethyl-1-trimethylsilylocta-1,6-diyn-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10664651 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | tert-butyl-(4,4-dimethyl-1-trimethylsilylocta-1,6-diyn-3-yl)oxy-dimethylsilane |
| SMILES | CC#CCC(C)(C)C(C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi2/c1-12-13-15-19(5,6)17(14-16-21(7,8)9)20-22(10,11)18(2,3)4/h17H,15H2,1-11H3 |
| InChIKey | ZYUOMTHLUDAZMS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|