C17H21N2O3P — CID 10830393
N-hydroxy-2-[[methyl(phenyl)phosphoryl]-(2-phenylethyl)amino]acetamide (PubChem CID 10830393) has the molecular formula C17H21N2O3P and a molecular weight of 332.34 g/mol. Its IUPAC name is N-hydroxy-2-[[methyl(phenyl)phosphoryl]-(2-phenylethyl)amino]acetamide.
| Compound Name | N-hydroxy-2-[[methyl(phenyl)phosphoryl]-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 10830393 |
| Molecular Formula | C17H21N2O3P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-hydroxy-2-[[methyl(phenyl)phosphoryl]-(2-phenylethyl)amino]acetamide |
| SMILES | CP(=O)(c1ccccc1)N(CCc1ccccc1)CC(=O)NO |
| InChI | InChI=1S/C17H21N2O3P/c1-23(22,16-10-6-3-7-11-16)19(14-17(20)18-21)13-12-15-8-4-2-5-9-15/h2-11,21H,12-14H2,1H3,(H,18,20) |
| InChIKey | LMQSRMOBSSJUST-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|