C20H36O4 — CID 10831044
(2S,3S)-2,3-bis(2-methylbutan-2-yloxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 10831044) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(2-methylbutan-2-yloxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | (2S,3S)-2,3-bis(2-methylbutan-2-yloxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 10831044 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (2S,3S)-2,3-bis(2-methylbutan-2-yloxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | CCC(C)(C)OC[C@@H]1OC2(C=CCCC2)O[C@H]1COC(C)(C)CC |
| InChI | InChI=1S/C20H36O4/c1-7-18(3,4)21-14-16-17(15-22-19(5,6)8-2)24-20(23-16)12-10-9-11-13-20/h10,12,16-17H,7-9,11,13-15H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | ONSOBAYRMFDQHI-IRXDYDNUSA-N |
| XLogP | 4.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|