C22H32OSi — CID 10831057
[(4aZ)-8,8-dimethyl-6,7,11,12-tetradehydro-3,4,9,10-tetrahydro-2H-benzo[10]annulen-10-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10831057) has the molecular formula C22H32OSi and a molecular weight of 340.58 g/mol. Its IUPAC name is [(4aZ)-8,8-dimethyl-6,7,11,12-tetradehydro-3,4,9,10-tetrahydro-2H-benzo[10]annulen-10-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aZ)-8,8-dimethyl-6,7,11,12-tetradehydro-3,4,9,10-tetrahydro-2H-benzo[10]annulen-10-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10831057 |
| Molecular Formula | C22H32OSi |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(4aZ)-8,8-dimethyl-6,7,11,12-tetradehydro-3,4,9,10-tetrahydro-2H-benzo[10]annulen-10-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)C#C/C=C2/CCCC=C2C#CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H32OSi/c1-21(2,3)24(6,7)23-20-15-14-19-12-9-8-11-18(19)13-10-16-22(4,5)17-20/h12-13,20H,8-9,11,17H2,1-7H3/b18-13- |
| InChIKey | WMEQHBWOGKCXCF-AQTBWJFISA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|