C23H34OSi — CID 10808070
tert-butyl-[[(10Z)-7,7-dimethyl-4-bicyclo[9.4.0]pentadeca-1(15),10-dien-2,8-diynyl]oxy]-dimethylsilane (PubChem CID 10808070) has the molecular formula C23H34OSi and a molecular weight of 354.61 g/mol. Its IUPAC name is tert-butyl-[[(10Z)-7,7-dimethyl-4-bicyclo[9.4.0]pentadeca-1(15),10-dien-2,8-diynyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(10Z)-7,7-dimethyl-4-bicyclo[9.4.0]pentadeca-1(15),10-dien-2,8-diynyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10808070 |
| Molecular Formula | C23H34OSi |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl-[[(10Z)-7,7-dimethyl-4-bicyclo[9.4.0]pentadeca-1(15),10-dien-2,8-diynyl]oxy]-dimethylsilane |
| SMILES | CC1(C)C#C/C=C2/CCCC=C2C#CC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H34OSi/c1-22(2,3)25(6,7)24-21-15-14-20-12-9-8-11-19(20)13-10-17-23(4,5)18-16-21/h12-13,21H,8-9,11,16,18H2,1-7H3/b19-13- |
| InChIKey | UQYDUZJUGACDOS-UYRXBGFRSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|