C36H64OSiSn — CID 11849254
tert-butyl-dimethyl-[(1R)-3,5,5-trimethyl-4-[(3E,5Z,7E)-3-methyl-8-tributylstannylocta-3,5,7-trien-1-ynyl]cyclohex-3-en-1-yl]oxysilane (PubChem CID 11849254) has the molecular formula C36H64OSiSn and a molecular weight of 659.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-3,5,5-trimethyl-4-[(3E,5Z,7E)-3-methyl-8-tributylstannylocta-3,5,7-trien-1-ynyl]cyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R)-3,5,5-trimethyl-4-[(3E,5Z,7E)-3-methyl-8-tributylstannylocta-3,5,7-trien-1-ynyl]cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11849254 |
| Molecular Formula | C36H64OSiSn |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-3,5,5-trimethyl-4-[(3E,5Z,7E)-3-methyl-8-tributylstannylocta-3,5,7-trien-1-ynyl]cyclohex-3-en-1-yl]oxysilane |
| SMILES | CCCC[Sn](/C=C/C=C\C=C(/C)C#CC1=C(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC1(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C24H37OSi.3C4H9.Sn/c1-11-12-13-14-19(2)15-16-22-20(3)17-21(18-24(22,7)8)25-26(9,10)23(4,5)6;3*1-3-4-2;/h1,11-14,21H,17-18H2,2-10H3;3*1,3-4H2,2H3;/b11-1?,13-12-,19-14+;;;;/t21-;;;;/m1..../s1 |
| InChIKey | FBSHLPXIZGVBDD-GRJYAVRUSA-N |
| XLogP | 11.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|