C19H18ClNO3 — CID 10831265
2-chloro-5,6,8-trimethoxy-7-methyl-4-phenylquinoline (PubChem CID 10831265) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-chloro-5,6,8-trimethoxy-7-methyl-4-phenylquinoline.
| Compound Name | 2-chloro-5,6,8-trimethoxy-7-methyl-4-phenylquinoline |
|---|---|
| PubChem CID | 10831265 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-chloro-5,6,8-trimethoxy-7-methyl-4-phenylquinoline |
| SMILES | COc1c(C)c(OC)c2nc(Cl)cc(-c3ccccc3)c2c1OC |
| InChI | InChI=1S/C19H18ClNO3/c1-11-17(22-2)16-15(19(24-4)18(11)23-3)13(10-14(20)21-16)12-8-6-5-7-9-12/h5-10H,1-4H3 |
| InChIKey | PVAVGRNOGXOWSX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|