C15H8ClF3N2O2S — CID 1083208
2-[[6-(4-chlorophenyl)-3-cyano-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid (PubChem CID 1083208) has the molecular formula C15H8ClF3N2O2S and a molecular weight of 372.76 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-3-cyano-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid.
| Compound Name | 2-[[6-(4-chlorophenyl)-3-cyano-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 1083208 |
| Molecular Formula | C15H8ClF3N2O2S |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-3-cyano-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetic acid |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2ccc(Cl)cc2)nc1SCC(=O)O |
| InChI | InChI=1S/C15H8ClF3N2O2S/c16-9-3-1-8(2-4-9)12-5-11(15(17,18)19)10(6-20)14(21-12)24-7-13(22)23/h1-5H,7H2,(H,22,23) |
| InChIKey | RAAQFQAWKVLAMI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |