C17H16N4OS2 — CID 10832127
4,5-dimethyl-11-[(4-methylanilino)methyl]-6,10-dithia-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 10832127) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 4,5-dimethyl-11-[(4-methylanilino)methyl]-6,10-dithia-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 4,5-dimethyl-11-[(4-methylanilino)methyl]-6,10-dithia-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 10832127 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4,5-dimethyl-11-[(4-methylanilino)methyl]-6,10-dithia-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | Cc1ccc(NCc2nn3c(=O)c4c(C)c(C)sc4nc3s2)cc1 |
| InChI | InChI=1S/C17H16N4OS2/c1-9-4-6-12(7-5-9)18-8-13-20-21-16(22)14-10(2)11(3)23-15(14)19-17(21)24-13/h4-7,18H,8H2,1-3H3 |
| InChIKey | WARACFYKCVCWAG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |