C15H19NO5S2 — CID 10832183
methyl (6S)-6-[2-(5-ethoxycarbonylthiophen-2-yl)ethyl]-3-oxothiomorpholine-2-carboxylate (PubChem CID 10832183) has the molecular formula C15H19NO5S2 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl (6S)-6-[2-(5-ethoxycarbonylthiophen-2-yl)ethyl]-3-oxothiomorpholine-2-carboxylate.
| Compound Name | methyl (6S)-6-[2-(5-ethoxycarbonylthiophen-2-yl)ethyl]-3-oxothiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 10832183 |
| Molecular Formula | C15H19NO5S2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | methyl (6S)-6-[2-(5-ethoxycarbonylthiophen-2-yl)ethyl]-3-oxothiomorpholine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CC[C@H]2CNC(=O)C(C(=O)OC)S2)s1 |
| InChI | InChI=1S/C15H19NO5S2/c1-3-21-14(18)11-7-6-9(22-11)4-5-10-8-16-13(17)12(23-10)15(19)20-2/h6-7,10,12H,3-5,8H2,1-2H3,(H,16,17)/t10-,12?/m0/s1 |
| InChIKey | QSZKXQIGVNNKPB-NUHJPDEHSA-N |
| XLogP | 1.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|