C16H27O7PS — CID 57000724
ethyl 5-(3-diethoxyphosphoryl-3,3-dimethoxypropyl)thiophene-2-carboxylate (PubChem CID 57000724) has the molecular formula C16H27O7PS and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 5-(3-diethoxyphosphoryl-3,3-dimethoxypropyl)thiophene-2-carboxylate.
| Compound Name | ethyl 5-(3-diethoxyphosphoryl-3,3-dimethoxypropyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 57000724 |
| Molecular Formula | C16H27O7PS |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | ethyl 5-(3-diethoxyphosphoryl-3,3-dimethoxypropyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CCC(OC)(OC)P(=O)(OCC)OCC)s1 |
| InChI | InChI=1S/C16H27O7PS/c1-6-21-15(17)14-10-9-13(25-14)11-12-16(19-4,20-5)24(18,22-7-2)23-8-3/h9-10H,6-8,11-12H2,1-5H3 |
| InChIKey | GPHDNEVXDQHCMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|