C18H36O5Si — CID 10832397
(3S,4R)-4-[4-(2-methoxyethoxymethoxy)-4-methylpentyl]-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one (PubChem CID 10832397) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (3S,4R)-4-[4-(2-methoxyethoxymethoxy)-4-methylpentyl]-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one.
| Compound Name | (3S,4R)-4-[4-(2-methoxyethoxymethoxy)-4-methylpentyl]-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one |
|---|---|
| PubChem CID | 10832397 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (3S,4R)-4-[4-(2-methoxyethoxymethoxy)-4-methylpentyl]-3-[(1R)-1-trimethylsilylethyl]oxetan-2-one |
| SMILES | COCCOCOC(C)(C)CCC[C@H]1OC(=O)[C@H]1[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C18H36O5Si/c1-14(24(5,6)7)16-15(23-17(16)19)9-8-10-18(2,3)22-13-21-12-11-20-4/h14-16H,8-13H2,1-7H3/t14-,15-,16+/m1/s1 |
| InChIKey | KNFVKNBGUJTCOT-OAGGEKHMSA-N |
| XLogP | 3.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|