C30H60O5Si2 — CID 101382905
(2S,3R,6R)-2,6-bis[4-tri(propan-2-yl)silyloxybutyl]-1,4-dioxaspiro[2.3]hexan-5-one (PubChem CID 101382905) has the molecular formula C30H60O5Si2 and a molecular weight of 556.98 g/mol. Its IUPAC name is (2S,3R,6R)-2,6-bis[4-tri(propan-2-yl)silyloxybutyl]-1,4-dioxaspiro[2.3]hexan-5-one.
| Compound Name | (2S,3R,6R)-2,6-bis[4-tri(propan-2-yl)silyloxybutyl]-1,4-dioxaspiro[2.3]hexan-5-one |
|---|---|
| PubChem CID | 101382905 |
| Molecular Formula | C30H60O5Si2 |
| Molecular Weight | 556.98 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | (2S,3R,6R)-2,6-bis[4-tri(propan-2-yl)silyloxybutyl]-1,4-dioxaspiro[2.3]hexan-5-one |
| SMILES | CC(C)[Si](OCCCC[C@@H]1O[C@]12OC(=O)[C@@H]2CCCCO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H60O5Si2/c1-21(2)36(22(3)4,23(5)6)32-19-15-13-17-27-29(31)35-30(27)28(34-30)18-14-16-20-33-37(24(7)8,25(9)10)26(11)12/h21-28H,13-20H2,1-12H3/t27-,28-,30+/m0/s1 |
| InChIKey | SWYHGPKQTTUPRK-TWLDFKIOSA-N |
| XLogP | 8.98 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.98 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|