C27H54O5Si2 — CID 11420935
methyl (4R,5R,7S,8S,12R)-8,12-dimethyl-5-propan-2-yl-4,7-bis(trimethylsilyloxy)-15-oxabicyclo[12.1.0]pentadecane-2-carboxylate (PubChem CID 11420935) has the molecular formula C27H54O5Si2 and a molecular weight of 514.90 g/mol. Its IUPAC name is methyl (4R,5R,7S,8S,12R)-8,12-dimethyl-5-propan-2-yl-4,7-bis(trimethylsilyloxy)-15-oxabicyclo[12.1.0]pentadecane-2-carboxylate.
| Compound Name | methyl (4R,5R,7S,8S,12R)-8,12-dimethyl-5-propan-2-yl-4,7-bis(trimethylsilyloxy)-15-oxabicyclo[12.1.0]pentadecane-2-carboxylate |
|---|---|
| PubChem CID | 11420935 |
| Molecular Formula | C27H54O5Si2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | methyl (4R,5R,7S,8S,12R)-8,12-dimethyl-5-propan-2-yl-4,7-bis(trimethylsilyloxy)-15-oxabicyclo[12.1.0]pentadecane-2-carboxylate |
| SMILES | COC(=O)C1C[C@@H](O[Si](C)(C)C)[C@@H](C(C)C)C[C@H](O[Si](C)(C)C)[C@@H](C)CCC[C@@H](C)CC2OC21 |
| InChI | InChI=1S/C27H54O5Si2/c1-18(2)21-16-23(31-33(6,7)8)20(4)14-12-13-19(3)15-25-26(30-25)22(27(28)29-5)17-24(21)32-34(9,10)11/h18-26H,12-17H2,1-11H3/t19-,20+,21-,22?,23+,24-,25?,26?/m1/s1 |
| InChIKey | BWXLRPQVNNTGQO-QWDVFOLWSA-N |
| XLogP | 6.88 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|