C24H54O4Si3 — CID 6421185
trimethylsilyl 7,11-dimethyl-3-trimethylsilyloxy-3-(trimethylsilyloxymethyl)dodecanoate (PubChem CID 6421185) has the molecular formula C24H54O4Si3 and a molecular weight of 490.95 g/mol. Its IUPAC name is trimethylsilyl 7,11-dimethyl-3-trimethylsilyloxy-3-(trimethylsilyloxymethyl)dodecanoate.
| Compound Name | trimethylsilyl 7,11-dimethyl-3-trimethylsilyloxy-3-(trimethylsilyloxymethyl)dodecanoate |
|---|---|
| PubChem CID | 6421185 |
| Molecular Formula | C24H54O4Si3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | trimethylsilyl 7,11-dimethyl-3-trimethylsilyloxy-3-(trimethylsilyloxymethyl)dodecanoate |
| SMILES | CC(C)CCCC(C)CCCC(CO[Si](C)(C)C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H54O4Si3/c1-21(2)15-13-16-22(3)17-14-18-24(28-31(10,11)12,20-26-29(4,5)6)19-23(25)27-30(7,8)9/h21-22H,13-20H2,1-12H3 |
| InChIKey | RHUJESKQFXYVEQ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|